C18H19NO5 — CID 58343342
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(4-hydroxyphenyl)benzamide (PubChem CID 58343342) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(4-hydroxyphenyl)benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 58343342 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-(4-hydroxyphenyl)benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(-c2ccc(O)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C18H19NO5/c1-11(21)17(16(23)10-20)19-18(24)14-4-2-12(3-5-14)13-6-8-15(22)9-7-13/h2-9,11,17,20-22H,10H2,1H3,(H,19,24)/t11-,17+/m1/s1 |
| InChIKey | GHXIKUOPWBZSRR-DIFFPNOSSA-N |
| XLogP | 1.10 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |