C23H21NO4 — CID 58343433
N-(1,4-dihydroxy-3-oxo-1-phenylbutan-2-yl)-4-phenylbenzamide (PubChem CID 58343433) has the molecular formula C23H21NO4 and a molecular weight of 375.42 g/mol. Its IUPAC name is N-(1,4-dihydroxy-3-oxo-1-phenylbutan-2-yl)-4-phenylbenzamide.
| Compound Name | N-(1,4-dihydroxy-3-oxo-1-phenylbutan-2-yl)-4-phenylbenzamide |
|---|---|
| PubChem CID | 58343433 |
| Molecular Formula | C23H21NO4 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | N-(1,4-dihydroxy-3-oxo-1-phenylbutan-2-yl)-4-phenylbenzamide |
| SMILES | O=C(NC(C(=O)CO)C(O)c1ccccc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21NO4/c25-15-20(26)21(22(27)18-9-5-2-6-10-18)24-23(28)19-13-11-17(12-14-19)16-7-3-1-4-8-16/h1-14,21-22,25,27H,15H2,(H,24,28) |
| InChIKey | RRRLQVVNVUMJRQ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |