C22H27NO4 — CID 58343538
4-(4-butylphenyl)-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide (PubChem CID 58343538) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-(4-butylphenyl)-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide.
| Compound Name | 4-(4-butylphenyl)-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide |
|---|---|
| PubChem CID | 58343538 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 4-(4-butylphenyl)-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide |
| SMILES | CCCCc1ccc(-c2ccc(C(=O)N[C@H](C(=O)CO)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-3-4-5-16-6-8-17(9-7-16)18-10-12-19(13-11-18)22(27)23-21(15(2)25)20(26)14-24/h6-13,15,21,24-25H,3-5,14H2,1-2H3,(H,23,27)/t15-,21+/m1/s1 |
| InChIKey | NHMMVASPJPOADZ-VFNWGFHPSA-N |
| XLogP | 2.74 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |