C26H27NO4 — CID 58343429
4-[4-(4-butylphenyl)buta-1,3-diynyl]-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide (PubChem CID 58343429) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is 4-[4-(4-butylphenyl)buta-1,3-diynyl]-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide.
| Compound Name | 4-[4-(4-butylphenyl)buta-1,3-diynyl]-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide |
|---|---|
| PubChem CID | 58343429 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 4-[4-(4-butylphenyl)buta-1,3-diynyl]-N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]benzamide |
| SMILES | CCCCc1ccc(C#CC#Cc2ccc(C(=O)N[C@H](C(=O)CO)[C@@H](C)O)cc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c1-3-4-7-20-10-12-21(13-11-20)8-5-6-9-22-14-16-23(17-15-22)26(31)27-25(19(2)29)24(30)18-28/h10-17,19,25,28-29H,3-4,7,18H2,1-2H3,(H,27,31)/t19-,25+/m1/s1 |
| InChIKey | BMCYWPKUMOQCKA-CLOONOSVSA-N |
| XLogP | 2.47 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|