C31H27FN2O5 — CID 58343255
N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-[3-(4-fluorophenyl)propanoylamino]phenyl]buta-1,3-diynyl]benzamide (PubChem CID 58343255) has the molecular formula C31H27FN2O5 and a molecular weight of 526.56 g/mol. Its IUPAC name is N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-[3-(4-fluorophenyl)propanoylamino]phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-[3-(4-fluorophenyl)propanoylamino]phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 58343255 |
| Molecular Formula | C31H27FN2O5 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | N-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-4-[4-[4-[3-(4-fluorophenyl)propanoylamino]phenyl]buta-1,3-diynyl]benzamide |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CCc3ccc(F)cc3)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C31H27FN2O5/c1-21(36)30(28(37)20-35)34-31(39)25-13-6-22(7-14-25)4-2-3-5-23-10-17-27(18-11-23)33-29(38)19-12-24-8-15-26(32)16-9-24/h6-11,13-18,21,30,35-36H,12,19-20H2,1H3,(H,33,38)(H,34,39)/t21-,30+/m1/s1 |
| InChIKey | SVYFWRVKFFMDIK-DFXYEROKSA-N |
| XLogP | 2.84 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|