C29H33N3O4 — CID 59151012
(2R)-2-[[4-[4-[(4-butylphenyl)carbamoylamino]phenyl]benzoyl]amino]-3-methylbutanoic acid (PubChem CID 59151012) has the molecular formula C29H33N3O4 and a molecular weight of 487.60 g/mol. Its IUPAC name is (2R)-2-[[4-[4-[(4-butylphenyl)carbamoylamino]phenyl]benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[4-[4-[(4-butylphenyl)carbamoylamino]phenyl]benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 59151012 |
| Molecular Formula | C29H33N3O4 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | (2R)-2-[[4-[4-[(4-butylphenyl)carbamoylamino]phenyl]benzoyl]amino]-3-methylbutanoic acid |
| SMILES | CCCCc1ccc(NC(=O)Nc2ccc(-c3ccc(C(=O)N[C@@H](C(=O)O)C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C29H33N3O4/c1-4-5-6-20-7-15-24(16-8-20)30-29(36)31-25-17-13-22(14-18-25)21-9-11-23(12-10-21)27(33)32-26(19(2)3)28(34)35/h7-19,26H,4-6H2,1-3H3,(H,32,33)(H,34,35)(H2,30,31,36)/t26-/m1/s1 |
| InChIKey | JQXFYNUNFKQEAD-AREMUKBSSA-N |
| XLogP | 6.18 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |