C28H35N3O4S — CID 67150315
3-methyl-2-[[3-methyl-5-[4-[(4-pentylbenzoyl)amino]phenyl]-2H-1,3-thiazole-2-carbonyl]amino]butanoic acid (PubChem CID 67150315) has the molecular formula C28H35N3O4S and a molecular weight of 509.67 g/mol. Its IUPAC name is 3-methyl-2-[[3-methyl-5-[4-[(4-pentylbenzoyl)amino]phenyl]-2H-1,3-thiazole-2-carbonyl]amino]butanoic acid.
| Compound Name | 3-methyl-2-[[3-methyl-5-[4-[(4-pentylbenzoyl)amino]phenyl]-2H-1,3-thiazole-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 67150315 |
| Molecular Formula | C28H35N3O4S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | 3-methyl-2-[[3-methyl-5-[4-[(4-pentylbenzoyl)amino]phenyl]-2H-1,3-thiazole-2-carbonyl]amino]butanoic acid |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(C3=CN(C)C(C(=O)NC(C(=O)O)C(C)C)S3)cc2)cc1 |
| InChI | InChI=1S/C28H35N3O4S/c1-5-6-7-8-19-9-11-21(12-10-19)25(32)29-22-15-13-20(14-16-22)23-17-31(4)27(36-23)26(33)30-24(18(2)3)28(34)35/h9-18,24,27H,5-8H2,1-4H3,(H,29,32)(H,30,33)(H,34,35) |
| InChIKey | RHYHKFPIZKHVPK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|