C24H26N2O3S — CID 56928327
3-[5-[4-[(4-pentylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]propanoic acid (PubChem CID 56928327) has the molecular formula C24H26N2O3S and a molecular weight of 422.55 g/mol. Its IUPAC name is 3-[5-[4-[(4-pentylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]propanoic acid.
| Compound Name | 3-[5-[4-[(4-pentylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 56928327 |
| Molecular Formula | C24H26N2O3S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3-[5-[4-[(4-pentylbenzoyl)amino]phenyl]-1,3-thiazol-2-yl]propanoic acid |
| SMILES | CCCCCc1ccc(C(=O)Nc2ccc(-c3cnc(CCC(=O)O)s3)cc2)cc1 |
| InChI | InChI=1S/C24H26N2O3S/c1-2-3-4-5-17-6-8-19(9-7-17)24(29)26-20-12-10-18(11-13-20)21-16-25-22(30-21)14-15-23(27)28/h6-13,16H,2-5,14-15H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | XTFZIJJTDMXFEX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|