C21H26N2O3S — CID 142039488
(2R)-3-methyl-2-[[4-[(4-propylbenzoyl)amino]phenyl]sulfanylamino]butanoic acid (PubChem CID 142039488) has the molecular formula C21H26N2O3S and a molecular weight of 386.52 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[4-[(4-propylbenzoyl)amino]phenyl]sulfanylamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[4-[(4-propylbenzoyl)amino]phenyl]sulfanylamino]butanoic acid |
|---|---|
| PubChem CID | 142039488 |
| Molecular Formula | C21H26N2O3S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | (2R)-3-methyl-2-[[4-[(4-propylbenzoyl)amino]phenyl]sulfanylamino]butanoic acid |
| SMILES | CCCc1ccc(C(=O)Nc2ccc(SN[C@@H](C(=O)O)C(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O3S/c1-4-5-15-6-8-16(9-7-15)20(24)22-17-10-12-18(13-11-17)27-23-19(14(2)3)21(25)26/h6-14,19,23H,4-5H2,1-3H3,(H,22,24)(H,25,26)/t19-/m1/s1 |
| InChIKey | YZHANQOGZSZGTR-LJQANCHMSA-N |
| XLogP | 4.60 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|