C31H37NO7 — CID 158236198
tert-butyl 7-[5-[4-[4-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]furan-2-yl]heptanoate (PubChem CID 158236198) has the molecular formula C31H37NO7 and a molecular weight of 535.64 g/mol. Its IUPAC name is tert-butyl 7-[5-[4-[4-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]furan-2-yl]heptanoate.
| Compound Name | tert-butyl 7-[5-[4-[4-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]furan-2-yl]heptanoate |
|---|---|
| PubChem CID | 158236198 |
| Molecular Formula | C31H37NO7 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.26 |
| IUPAC Name | tert-butyl 7-[5-[4-[4-[[(2S,3R)-3-hydroxy-1-methoxy-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]furan-2-yl]heptanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(C#CC#Cc2ccc(CCCCCCC(=O)OC(C)(C)C)o2)cc1)[C@@H](C)O |
| InChI | InChI=1S/C31H37NO7/c1-22(33)28(30(36)37-5)32-29(35)24-18-16-23(17-19-24)12-10-11-14-26-21-20-25(38-26)13-8-6-7-9-15-27(34)39-31(2,3)4/h16-22,28,33H,6-9,13,15H2,1-5H3,(H,32,35)/t22-,28+/m1/s1 |
| InChIKey | GEZJORSQEKLFNG-DFHRPNOPSA-N |
| XLogP | 4.17 |
| TPSA | 115.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|