C19H23BrN2O5 — CID 118161235
methyl (2S,3R)-2-[[4-(2-bromoethynyl)benzoyl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 118161235) has the molecular formula C19H23BrN2O5 and a molecular weight of 439.31 g/mol. Its IUPAC name is methyl (2S,3R)-2-[[4-(2-bromoethynyl)benzoyl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | methyl (2S,3R)-2-[[4-(2-bromoethynyl)benzoyl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 118161235 |
| Molecular Formula | C19H23BrN2O5 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | methyl (2S,3R)-2-[[4-(2-bromoethynyl)benzoyl]amino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(C#CBr)cc1)[C@@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H23BrN2O5/c1-12(21-18(25)27-19(2,3)4)15(17(24)26-5)22-16(23)14-8-6-13(7-9-14)10-11-20/h6-9,12,15H,1-5H3,(H,21,25)(H,22,23)/t12-,15+/m1/s1 |
| InChIKey | NHZSSLXQWVWKDF-DOMZBBRYSA-N |
| XLogP | 2.58 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|