C16H20N2O4 — CID 118177902
methyl (2S)-3-amino-2-[[4-(3-hydroxyprop-1-ynyl)benzoyl]amino]-3-methylbutanoate (PubChem CID 118177902) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is methyl (2S)-3-amino-2-[[4-(3-hydroxyprop-1-ynyl)benzoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-3-amino-2-[[4-(3-hydroxyprop-1-ynyl)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 118177902 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | methyl (2S)-3-amino-2-[[4-(3-hydroxyprop-1-ynyl)benzoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(C#CCO)cc1)C(C)(C)N |
| InChI | InChI=1S/C16H20N2O4/c1-16(2,17)13(15(21)22-3)18-14(20)12-8-6-11(7-9-12)5-4-10-19/h6-9,13,19H,10,17H2,1-3H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | CEMWKAPVXHSMRU-CYBMUJFWSA-N |
| XLogP | 0.04 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|