C18H22N2O4 — CID 123373261
methyl (2S)-3-amino-2-[[4-(5-hydroxypent-3-en-1-ynyl)benzoyl]amino]-3-methylbutanoate (PubChem CID 123373261) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is methyl (2S)-3-amino-2-[[4-(5-hydroxypent-3-en-1-ynyl)benzoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-3-amino-2-[[4-(5-hydroxypent-3-en-1-ynyl)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 123373261 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | methyl (2S)-3-amino-2-[[4-(5-hydroxypent-3-en-1-ynyl)benzoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(C#CC=CCO)cc1)C(C)(C)N |
| InChI | InChI=1S/C18H22N2O4/c1-18(2,19)15(17(23)24-3)20-16(22)14-10-8-13(9-11-14)7-5-4-6-12-21/h4,6,8-11,15,21H,12,19H2,1-3H3,(H,20,22)/t15-/m1/s1 |
| InChIKey | WGUPHVKWFHBYML-OAHLLOKOSA-N |
| XLogP | 0.60 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|