C15H16BrNO4 — CID 118161124
methyl 2-[[4-(2-bromoethynyl)benzoyl]amino]-3-hydroxy-3-methylbutanoate (PubChem CID 118161124) has the molecular formula C15H16BrNO4 and a molecular weight of 354.20 g/mol. Its IUPAC name is methyl 2-[[4-(2-bromoethynyl)benzoyl]amino]-3-hydroxy-3-methylbutanoate.
| Compound Name | methyl 2-[[4-(2-bromoethynyl)benzoyl]amino]-3-hydroxy-3-methylbutanoate |
|---|---|
| PubChem CID | 118161124 |
| Molecular Formula | C15H16BrNO4 |
| Molecular Weight | 354.20 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | methyl 2-[[4-(2-bromoethynyl)benzoyl]amino]-3-hydroxy-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(C#CBr)cc1)C(C)(C)O |
| InChI | InChI=1S/C15H16BrNO4/c1-15(2,20)12(14(19)21-3)17-13(18)11-6-4-10(5-7-11)8-9-16/h4-7,12,20H,1-3H3,(H,17,18) |
| InChIKey | RAAWQYGLJGQEFJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|