C26H32N2O6S3 — CID 132564672
methyl 2-benzamido-3-[(3-benzamido-4-methoxy-2-methyl-4-oxobutan-2-yl)trisulfanyl]-3-methylbutanoate (PubChem CID 132564672) has the molecular formula C26H32N2O6S3 and a molecular weight of 564.75 g/mol. Its IUPAC name is methyl 2-benzamido-3-[(3-benzamido-4-methoxy-2-methyl-4-oxobutan-2-yl)trisulfanyl]-3-methylbutanoate.
| Compound Name | methyl 2-benzamido-3-[(3-benzamido-4-methoxy-2-methyl-4-oxobutan-2-yl)trisulfanyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 132564672 |
| Molecular Formula | C26H32N2O6S3 |
| Molecular Weight | 564.75 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | methyl 2-benzamido-3-[(3-benzamido-4-methoxy-2-methyl-4-oxobutan-2-yl)trisulfanyl]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1ccccc1)C(C)(C)SSSC(C)(C)C(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C26H32N2O6S3/c1-25(2,19(23(31)33-5)27-21(29)17-13-9-7-10-14-17)35-37-36-26(3,4)20(24(32)34-6)28-22(30)18-15-11-8-12-16-18/h7-16,19-20H,1-6H3,(H,27,29)(H,28,30) |
| InChIKey | FZSYJTLHQTVCIN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.75 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|