C19H23N3O3 — CID 66634538
methyl (2S)-3-amino-2-[[4-(2-aminophenyl)benzoyl]amino]-3-methylbutanoate (PubChem CID 66634538) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl (2S)-3-amino-2-[[4-(2-aminophenyl)benzoyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-3-amino-2-[[4-(2-aminophenyl)benzoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 66634538 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl (2S)-3-amino-2-[[4-(2-aminophenyl)benzoyl]amino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(-c2ccccc2N)cc1)C(C)(C)N |
| InChI | InChI=1S/C19H23N3O3/c1-19(2,21)16(18(24)25-3)22-17(23)13-10-8-12(9-11-13)14-6-4-5-7-15(14)20/h4-11,16H,20-21H2,1-3H3,(H,22,23)/t16-/m1/s1 |
| InChIKey | BOFRCEPXUWEERP-MRXNPFEDSA-N |
| XLogP | 1.94 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|