C23H30N2O6S — CID 175053137
methyl (2S)-3-amino-3-methyl-2-[[4-[4-(3-methylsulfonylpropoxy)phenyl]benzoyl]amino]butanoate (PubChem CID 175053137) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is methyl (2S)-3-amino-3-methyl-2-[[4-[4-(3-methylsulfonylpropoxy)phenyl]benzoyl]amino]butanoate.
| Compound Name | methyl (2S)-3-amino-3-methyl-2-[[4-[4-(3-methylsulfonylpropoxy)phenyl]benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 175053137 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | methyl (2S)-3-amino-3-methyl-2-[[4-[4-(3-methylsulfonylpropoxy)phenyl]benzoyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(-c2ccc(OCCCS(C)(=O)=O)cc2)cc1)C(C)(C)N |
| InChI | InChI=1S/C23H30N2O6S/c1-23(2,24)20(22(27)30-3)25-21(26)18-8-6-16(7-9-18)17-10-12-19(13-11-17)31-14-5-15-32(4,28)29/h6-13,20H,5,14-15,24H2,1-4H3,(H,25,26)/t20-/m1/s1 |
| InChIKey | GCSYTLQTYCNSFH-HXUWFJFHSA-N |
| XLogP | 2.18 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|