C19H23NO7S — CID 170211568
(2S)-2-[[5-[4-(3-methylsulfonylpropoxy)phenyl]furan-2-carbonyl]amino]butanoic acid (PubChem CID 170211568) has the molecular formula C19H23NO7S and a molecular weight of 409.46 g/mol. Its IUPAC name is (2S)-2-[[5-[4-(3-methylsulfonylpropoxy)phenyl]furan-2-carbonyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[5-[4-(3-methylsulfonylpropoxy)phenyl]furan-2-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 170211568 |
| Molecular Formula | C19H23NO7S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | (2S)-2-[[5-[4-(3-methylsulfonylpropoxy)phenyl]furan-2-carbonyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)c1ccc(-c2ccc(OCCCS(C)(=O)=O)cc2)o1)C(=O)O |
| InChI | InChI=1S/C19H23NO7S/c1-3-15(19(22)23)20-18(21)17-10-9-16(27-17)13-5-7-14(8-6-13)26-11-4-12-28(2,24)25/h5-10,15H,3-4,11-12H2,1-2H3,(H,20,21)(H,22,23)/t15-/m0/s1 |
| InChIKey | HGIHREGSMHQLMJ-HNNXBMFYSA-N |
| XLogP | 2.35 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|