C19H23NO4 — CID 91779351
N-[1-(3-hydroxycyclobutyl)propyl]-5-(4-methoxyphenyl)furan-2-carboxamide (PubChem CID 91779351) has the molecular formula C19H23NO4 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[1-(3-hydroxycyclobutyl)propyl]-5-(4-methoxyphenyl)furan-2-carboxamide.
| Compound Name | N-[1-(3-hydroxycyclobutyl)propyl]-5-(4-methoxyphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 91779351 |
| Molecular Formula | C19H23NO4 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[1-(3-hydroxycyclobutyl)propyl]-5-(4-methoxyphenyl)furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1ccc(-c2ccc(OC)cc2)o1)C1CC(O)C1 |
| InChI | InChI=1S/C19H23NO4/c1-3-16(13-10-14(21)11-13)20-19(22)18-9-8-17(24-18)12-4-6-15(23-2)7-5-12/h4-9,13-14,16,21H,3,10-11H2,1-2H3,(H,20,22) |
| InChIKey | HHSIAEQFXWHNMB-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |