C22H31N3O6S — CID 175053344
N-[(1S,2S)-3-amino-1-hydroxy-1-(hydroxyamino)-3-methylbutan-2-yl]-4-[4-(3-methylsulfonylpropoxy)phenyl]benzamide (PubChem CID 175053344) has the molecular formula C22H31N3O6S and a molecular weight of 465.57 g/mol. Its IUPAC name is N-[(1S,2S)-3-amino-1-hydroxy-1-(hydroxyamino)-3-methylbutan-2-yl]-4-[4-(3-methylsulfonylpropoxy)phenyl]benzamide.
| Compound Name | N-[(1S,2S)-3-amino-1-hydroxy-1-(hydroxyamino)-3-methylbutan-2-yl]-4-[4-(3-methylsulfonylpropoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 175053344 |
| Molecular Formula | C22H31N3O6S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | N-[(1S,2S)-3-amino-1-hydroxy-1-(hydroxyamino)-3-methylbutan-2-yl]-4-[4-(3-methylsulfonylpropoxy)phenyl]benzamide |
| SMILES | CC(C)(N)[C@H](NC(=O)c1ccc(-c2ccc(OCCCS(C)(=O)=O)cc2)cc1)[C@H](O)NO |
| InChI | InChI=1S/C22H31N3O6S/c1-22(2,23)19(21(27)25-28)24-20(26)17-7-5-15(6-8-17)16-9-11-18(12-10-16)31-13-4-14-32(3,29)30/h5-12,19,21,25,27-28H,4,13-14,23H2,1-3H3,(H,24,26)/t19-,21+/m1/s1 |
| InChIKey | KUTFNOODXQTOFB-CTNGQTDRSA-N |
| XLogP | 1.30 |
| TPSA | 150.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|