C21H20N2O3 — CID 163704189
methyl 3-(methylideneamino)-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate (PubChem CID 163704189) has the molecular formula C21H20N2O3 and a molecular weight of 348.40 g/mol. Its IUPAC name is methyl 3-(methylideneamino)-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate.
| Compound Name | methyl 3-(methylideneamino)-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 163704189 |
| Molecular Formula | C21H20N2O3 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | methyl 3-(methylideneamino)-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate |
| SMILES | C=NC(C)C(NC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)OC |
| InChI | InChI=1S/C21H20N2O3/c1-15(22-2)19(21(25)26-3)23-20(24)18-13-11-17(12-14-18)10-9-16-7-5-4-6-8-16/h4-8,11-15,19H,2H2,1,3H3,(H,23,24) |
| InChIKey | KDPPPHNSSFJCFC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|