C20H18N4O3 — CID 91316314
methyl (2S,3R)-3-azido-2-[[3-(2-phenylethynyl)benzoyl]amino]butanoate (PubChem CID 91316314) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is methyl (2S,3R)-3-azido-2-[[3-(2-phenylethynyl)benzoyl]amino]butanoate.
| Compound Name | methyl (2S,3R)-3-azido-2-[[3-(2-phenylethynyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 91316314 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl (2S,3R)-3-azido-2-[[3-(2-phenylethynyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1cccc(C#Cc2ccccc2)c1)[C@@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C20H18N4O3/c1-14(23-24-21)18(20(26)27-2)22-19(25)17-10-6-9-16(13-17)12-11-15-7-4-3-5-8-15/h3-10,13-14,18H,1-2H3,(H,22,25)/t14-,18+/m1/s1 |
| InChIKey | VBBDZORLUVHQBA-KDOFPFPSSA-N |
| XLogP | 3.06 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|