C39H37N7O6 — CID 161091578
N-[(3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(2-phenylethynyl)benzamide;methyl (3R)-3-azido-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate (PubChem CID 161091578) has the molecular formula C39H37N7O6 and a molecular weight of 699.77 g/mol. Its IUPAC name is N-[(3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(2-phenylethynyl)benzamide;methyl (3R)-3-azido-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate.
| Compound Name | N-[(3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(2-phenylethynyl)benzamide;methyl (3R)-3-azido-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate |
|---|---|
| PubChem CID | 161091578 |
| Molecular Formula | C39H37N7O6 |
| Molecular Weight | 699.77 g/mol |
| Exact Mass | 699.28 |
| IUPAC Name | N-[(3R)-3-amino-1-(hydroxyamino)-1-oxobutan-2-yl]-4-(2-phenylethynyl)benzamide;methyl (3R)-3-azido-2-[[4-(2-phenylethynyl)benzoyl]amino]butanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(C#Cc2ccccc2)cc1)[C@@H](C)N=[N+]=[N-].C[C@@H](N)C(NC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C20H18N4O3.C19H19N3O3/c1-14(23-24-21)18(20(26)27-2)22-19(25)17-12-10-16(11-13-17)9-8-15-6-4-3-5-7-15;1-13(20)17(19(24)22-25)21-18(23)16-11-9-15(10-12-16)8-7-14-5-3-2-4-6-14/h3-7,10-14,18H,1-2H3,(H,22,25);2-6,9-13,17,25H,20H2,1H3,(H,21,23)(H,22,24)/t14-,18?;13-,17?/m11/s1 |
| InChIKey | UHGCCQFLFKVAFD-OCDNIGBMSA-N |
| XLogP | 4.09 |
| TPSA | 208.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|