C29H30N4O4 — CID 59416938
N-[(2S,3R)-1-(hydroxyamino)-1-oxo-3-[[2-[[(1R)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 59416938) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is N-[(2S,3R)-1-(hydroxyamino)-1-oxo-3-[[2-[[(1R)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[(2S,3R)-1-(hydroxyamino)-1-oxo-3-[[2-[[(1R)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 59416938 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | N-[(2S,3R)-1-(hydroxyamino)-1-oxo-3-[[2-[[(1R)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | C[C@@H](NCC(=O)N[C@H](C)[C@H](NC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)NO)c1ccccc1 |
| InChI | InChI=1S/C29H30N4O4/c1-20(24-11-7-4-8-12-24)30-19-26(34)31-21(2)27(29(36)33-37)32-28(35)25-17-15-23(16-18-25)14-13-22-9-5-3-6-10-22/h3-12,15-18,20-21,27,30,37H,19H2,1-2H3,(H,31,34)(H,32,35)(H,33,36)/t20-,21-,27+/m1/s1 |
| InChIKey | JBYTWJPOPIKZRU-GNMOFYLKSA-N |
| XLogP | 2.55 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|