C22H23N3O5 — CID 59697264
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[3-(propanoylamino)phenyl]ethynyl]benzamide (PubChem CID 59697264) has the molecular formula C22H23N3O5 and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[3-(propanoylamino)phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[3-(propanoylamino)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 59697264 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-[3-(propanoylamino)phenyl]ethynyl]benzamide |
| SMILES | CCC(=O)Nc1cccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc2)c1 |
| InChI | InChI=1S/C22H23N3O5/c1-3-19(27)23-18-6-4-5-16(13-18)8-7-15-9-11-17(12-10-15)21(28)24-20(14(2)26)22(29)25-30/h4-6,9-14,20,26,30H,3H2,1-2H3,(H,23,27)(H,24,28)(H,25,29)/t14-,20+/m1/s1 |
| InChIKey | DEIPOVQKAVQKHN-VLIAUNLRSA-N |
| XLogP | 1.42 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|