C20H20N2O5 — CID 59697903
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(3-methoxyphenyl)ethynyl]benzamide (PubChem CID 59697903) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(3-methoxyphenyl)ethynyl]benzamide.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(3-methoxyphenyl)ethynyl]benzamide |
|---|---|
| PubChem CID | 59697903 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[2-(3-methoxyphenyl)ethynyl]benzamide |
| SMILES | COc1cccc(C#Cc2ccc(C(=O)N[C@H](C(=O)NO)[C@@H](C)O)cc2)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-13(23)18(20(25)22-26)21-19(24)16-10-8-14(9-11-16)6-7-15-4-3-5-17(12-15)27-2/h3-5,8-13,18,23,26H,1-2H3,(H,21,24)(H,22,25)/t13-,18+/m1/s1 |
| InChIKey | GFDNBDFJUBKLFO-ACJLOTCBSA-N |
| XLogP | 1.08 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|