C23H25N3O6S — CID 158980278
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[3-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide;methane (PubChem CID 158980278) has the molecular formula C23H25N3O6S and a molecular weight of 471.54 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[3-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide;methane.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[3-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide;methane |
|---|---|
| PubChem CID | 158980278 |
| Molecular Formula | C23H25N3O6S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-4-[4-[3-(methanesulfonamido)phenyl]buta-1,3-diynyl]benzamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2cccc(NS(C)(=O)=O)c2)cc1)C(=O)NO |
| InChI | InChI=1S/C22H21N3O6S.CH4/c1-15(26)20(22(28)24-29)23-21(27)18-12-10-16(11-13-18)6-3-4-7-17-8-5-9-19(14-17)25-32(2,30)31;/h5,8-15,20,25-26,29H,1-2H3,(H,23,27)(H,24,28);1H4/t15-,20+;/m1./s1 |
| InChIKey | JOXGJTANJYQXDT-SWFRRQLPSA-N |
| XLogP | 1.08 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|