C27H29N3O4 — CID 161308225
4-[2-[4-(anilinomethyl)phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane (PubChem CID 161308225) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[2-[4-(anilinomethyl)phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane.
| Compound Name | 4-[2-[4-(anilinomethyl)phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
|---|---|
| PubChem CID | 161308225 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 4-[2-[4-(anilinomethyl)phenyl]ethynyl]-N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]benzamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1ccc(C#Cc2ccc(CNc3ccccc3)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H25N3O4.CH4/c1-18(30)24(26(32)29-33)28-25(31)22-15-13-20(14-16-22)8-7-19-9-11-21(12-10-19)17-27-23-5-3-2-4-6-23;/h2-6,9-16,18,24,27,30,33H,17H2,1H3,(H,28,31)(H,29,32);1H4/t18-,24+;/m1./s1 |
| InChIKey | VINUJXKVILCITG-YQVASJPASA-N |
| XLogP | 3.32 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|