C19H20N2O3 — CID 59697419
(2S,3R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methylamino]butanamide (PubChem CID 59697419) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is (2S,3R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methylamino]butanamide.
| Compound Name | (2S,3R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methylamino]butanamide |
|---|---|
| PubChem CID | 59697419 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | (2S,3R)-N,3-dihydroxy-2-[[4-(2-phenylethynyl)phenyl]methylamino]butanamide |
| SMILES | C[C@@H](O)[C@H](NCc1ccc(C#Cc2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C19H20N2O3/c1-14(22)18(19(23)21-24)20-13-17-11-9-16(10-12-17)8-7-15-5-3-2-4-6-15/h2-6,9-12,14,18,20,22,24H,13H2,1H3,(H,21,23)/t14-,18+/m1/s1 |
| InChIKey | DTJYVNPGWIWNMI-KDOFPFPSSA-N |
| XLogP | 1.43 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|