C26H29N3O5 — CID 87361818
tert-butyl N-[3-[4-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]methyl]phenyl]buta-1,3-diynyl]phenyl]carbamate (PubChem CID 87361818) has the molecular formula C26H29N3O5 and a molecular weight of 463.53 g/mol. Its IUPAC name is tert-butyl N-[3-[4-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]methyl]phenyl]buta-1,3-diynyl]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]methyl]phenyl]buta-1,3-diynyl]phenyl]carbamate |
|---|---|
| PubChem CID | 87361818 |
| Molecular Formula | C26H29N3O5 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | tert-butyl N-[3-[4-[4-[[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]amino]methyl]phenyl]buta-1,3-diynyl]phenyl]carbamate |
| SMILES | C[C@@H](O)[C@H](NCc1ccc(C#CC#Cc2cccc(NC(=O)OC(C)(C)C)c2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H29N3O5/c1-18(30)23(24(31)29-33)27-17-21-14-12-19(13-15-21)8-5-6-9-20-10-7-11-22(16-20)28-25(32)34-26(2,3)4/h7,10-16,18,23,27,30,33H,17H2,1-4H3,(H,28,32)(H,29,31)/t18-,23+/m1/s1 |
| InChIKey | OAWCHZVVMMYFOM-JPYJTQIMSA-N |
| XLogP | 2.78 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|