C24H36N4O2 — CID 126737371
tert-butyl N-[3-[2-amino-4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]anilino]phenyl]carbamate (PubChem CID 126737371) has the molecular formula C24H36N4O2 and a molecular weight of 412.58 g/mol. Its IUPAC name is tert-butyl N-[3-[2-amino-4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]anilino]phenyl]carbamate.
| Compound Name | tert-butyl N-[3-[2-amino-4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]anilino]phenyl]carbamate |
|---|---|
| PubChem CID | 126737371 |
| Molecular Formula | C24H36N4O2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.28 |
| IUPAC Name | tert-butyl N-[3-[2-amino-4-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]anilino]phenyl]carbamate |
| SMILES | C[C@H](NCc1ccc(Nc2cccc(NC(=O)OC(C)(C)C)c2)c(N)c1)C(C)(C)C |
| InChI | InChI=1S/C24H36N4O2/c1-16(23(2,3)4)26-15-17-11-12-21(20(25)13-17)27-18-9-8-10-19(14-18)28-22(29)30-24(5,6)7/h8-14,16,26-27H,15,25H2,1-7H3,(H,28,29)/t16-/m0/s1 |
| InChIKey | CNMKYNWYKOLEBU-INIZCTEOSA-N |
| XLogP | 5.88 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|