C26H27N3O6 — CID 87111053
tert-butyl-[4-[4-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]phenyl]carbamic acid (PubChem CID 87111053) has the molecular formula C26H27N3O6 and a molecular weight of 477.52 g/mol. Its IUPAC name is tert-butyl-[4-[4-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]phenyl]carbamic acid.
| Compound Name | tert-butyl-[4-[4-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 87111053 |
| Molecular Formula | C26H27N3O6 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | tert-butyl-[4-[4-[4-[[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]carbamoyl]phenyl]buta-1,3-diynyl]phenyl]carbamic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(N(C(=O)O)C(C)(C)C)cc2)cc1)C(=O)NO |
| InChI | InChI=1S/C26H27N3O6/c1-17(30)22(24(32)28-35)27-23(31)20-13-9-18(10-14-20)7-5-6-8-19-11-15-21(16-12-19)29(25(33)34)26(2,3)4/h9-17,22,30,35H,1-4H3,(H,27,31)(H,28,32)(H,33,34)/t17-,22+/m1/s1 |
| InChIKey | MMZUVMZWVXERRX-VGSWGCGISA-N |
| XLogP | 2.36 |
| TPSA | 139.20 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|