C18H22N2O5 — CID 157186209
N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-3-phenoxybenzamide;methane (PubChem CID 157186209) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-3-phenoxybenzamide;methane.
| Compound Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-3-phenoxybenzamide;methane |
|---|---|
| PubChem CID | 157186209 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[(2S,3R)-3-hydroxy-1-(hydroxyamino)-1-oxobutan-2-yl]-3-phenoxybenzamide;methane |
| SMILES | C.C[C@@H](O)[C@H](NC(=O)c1cccc(Oc2ccccc2)c1)C(=O)NO |
| InChI | InChI=1S/C17H18N2O5.CH4/c1-11(20)15(17(22)19-23)18-16(21)12-6-5-9-14(10-12)24-13-7-3-2-4-8-13;/h2-11,15,20,23H,1H3,(H,18,21)(H,19,22);1H4/t11-,15+;/m1./s1 |
| InChIKey | APDMUCXIXFVRGY-BTAXJDQBSA-N |
| XLogP | 2.10 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|