C29H29N3O4 — CID 58342387
N-[(2S)-4-hydroxy-3-oxo-1-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 58342387) has the molecular formula C29H29N3O4 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[(2S)-4-hydroxy-3-oxo-1-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[(2S)-4-hydroxy-3-oxo-1-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 58342387 |
| Molecular Formula | C29H29N3O4 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | N-[(2S)-4-hydroxy-3-oxo-1-[[2-[[(1S)-1-phenylethyl]amino]acetyl]amino]butan-2-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | C[C@H](NCC(=O)NC[C@H](NC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)CO)c1ccccc1 |
| InChI | InChI=1S/C29H29N3O4/c1-21(24-10-6-3-7-11-24)30-19-28(35)31-18-26(27(34)20-33)32-29(36)25-16-14-23(15-17-25)13-12-22-8-4-2-5-9-22/h2-11,14-17,21,26,30,33H,18-20H2,1H3,(H,31,35)(H,32,36)/t21-,26-/m0/s1 |
| InChIKey | PUSNULCKGGGJLS-LVXARBLLSA-N |
| XLogP | 2.21 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|