C23H24N2O4 — CID 58342473
N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[3-(2-oxobutyl)phenyl]ethynyl]benzamide (PubChem CID 58342473) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[3-(2-oxobutyl)phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[3-(2-oxobutyl)phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58342473 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[3-(2-oxobutyl)phenyl]ethynyl]benzamide |
| SMILES | CCC(=O)Cc1cccc(C#Cc2ccc(C(=O)N[C@@H](CN)C(=O)CO)cc2)c1 |
| InChI | InChI=1S/C23H24N2O4/c1-2-20(27)13-18-5-3-4-17(12-18)7-6-16-8-10-19(11-9-16)23(29)25-21(14-24)22(28)15-26/h3-5,8-12,21,26H,2,13-15,24H2,1H3,(H,25,29)/t21-/m0/s1 |
| InChIKey | OKLQWHMBOMJJMG-NRFANRHFSA-N |
| XLogP | 1.23 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|