C22H21N3O3 — CID 58343432
N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(aminomethyl)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 58343432) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(aminomethyl)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(aminomethyl)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 58343432 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(aminomethyl)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | NCc1cccc(C#CC#Cc2ccc(C(=O)N[C@@H](CN)C(=O)CO)cc2)c1 |
| InChI | InChI=1S/C22H21N3O3/c23-13-18-7-3-6-17(12-18)5-2-1-4-16-8-10-19(11-9-16)22(28)25-20(14-24)21(27)15-26/h3,6-12,20,26H,13-15,23-24H2,(H,25,28)/t20-/m0/s1 |
| InChIKey | VNTUDWQSUFASNA-FQEVSTJZSA-N |
| XLogP | 0.17 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|