C27H27N3O4 — CID 58342517
N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[4-(3-cyclopropylpropanoylamino)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 58342517) has the molecular formula C27H27N3O4 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[4-(3-cyclopropylpropanoylamino)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[4-(3-cyclopropylpropanoylamino)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 58342517 |
| Molecular Formula | C27H27N3O4 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[4-(3-cyclopropylpropanoylamino)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#CC#Cc2ccc(NC(=O)CCC3CC3)cc2)cc1)C(=O)CO |
| InChI | InChI=1S/C27H27N3O4/c28-17-24(25(32)18-31)30-27(34)22-12-7-19(8-13-22)3-1-2-4-20-9-14-23(15-10-20)29-26(33)16-11-21-5-6-21/h7-10,12-15,21,24,31H,5-6,11,16-18,28H2,(H,29,33)(H,30,34)/t24-/m0/s1 |
| InChIKey | YDYXGNJGMZVHSE-DEOSSOPVSA-N |
| XLogP | 1.84 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|