C24H23N3O4 — CID 58343298
N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(3-amino-2-oxopropyl)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 58343298) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(3-amino-2-oxopropyl)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(3-amino-2-oxopropyl)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 58343298 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(3-amino-2-oxopropyl)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | NCC(=O)Cc1cccc(C#CC#Cc2ccc(C(=O)N[C@@H](CN)C(=O)CO)cc2)c1 |
| InChI | InChI=1S/C24H23N3O4/c25-14-21(29)13-19-7-3-6-18(12-19)5-2-1-4-17-8-10-20(11-9-17)24(31)27-22(15-26)23(30)16-28/h3,6-12,22,28H,13-16,25-26H2,(H,27,31)/t22-/m0/s1 |
| InChIKey | FDQKVHKLAMTBMB-QFIPXVFZSA-N |
| XLogP | -0.22 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|