C22H17F3N2O3 — CID 58343416
N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(trifluoromethyl)phenyl]buta-1,3-diynyl]benzamide (PubChem CID 58343416) has the molecular formula C22H17F3N2O3 and a molecular weight of 414.38 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(trifluoromethyl)phenyl]buta-1,3-diynyl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(trifluoromethyl)phenyl]buta-1,3-diynyl]benzamide |
|---|---|
| PubChem CID | 58343416 |
| Molecular Formula | C22H17F3N2O3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[4-[3-(trifluoromethyl)phenyl]buta-1,3-diynyl]benzamide |
| SMILES | NC[C@H](NC(=O)c1ccc(C#CC#Cc2cccc(C(F)(F)F)c2)cc1)C(=O)CO |
| InChI | InChI=1S/C22H17F3N2O3/c23-22(24,25)18-7-3-6-16(12-18)5-2-1-4-15-8-10-17(11-9-15)21(30)27-19(13-26)20(29)14-28/h3,6-12,19,28H,13-14,26H2,(H,27,30)/t19-/m0/s1 |
| InChIKey | QXQBYSNOPHOGDY-IBGZPJMESA-N |
| XLogP | 1.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|