C30H37N3O4 — CID 58343260
N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[4-[3-(2,3-dimethylcyclohexyl)propanoylamino]phenyl]ethynyl]benzamide (PubChem CID 58343260) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[4-[3-(2,3-dimethylcyclohexyl)propanoylamino]phenyl]ethynyl]benzamide.
| Compound Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[4-[3-(2,3-dimethylcyclohexyl)propanoylamino]phenyl]ethynyl]benzamide |
|---|---|
| PubChem CID | 58343260 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | N-[(2S)-1-amino-4-hydroxy-3-oxobutan-2-yl]-4-[2-[4-[3-(2,3-dimethylcyclohexyl)propanoylamino]phenyl]ethynyl]benzamide |
| SMILES | CC1CCCC(CCC(=O)Nc2ccc(C#Cc3ccc(C(=O)N[C@@H](CN)C(=O)CO)cc3)cc2)C1C |
| InChI | InChI=1S/C30H37N3O4/c1-20-4-3-5-24(21(20)2)14-17-29(36)32-26-15-10-23(11-16-26)7-6-22-8-12-25(13-9-22)30(37)33-27(18-31)28(35)19-34/h8-13,15-16,20-21,24,27,34H,3-5,14,17-19,31H2,1-2H3,(H,32,36)(H,33,37)/t20?,21?,24?,27-/m0/s1 |
| InChIKey | DPVXPPNZFKVBQM-KNSJPHFTSA-N |
| XLogP | 3.50 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|