C18H18N4O3 — CID 71163007
methyl (2S,3R)-3-azido-2-[(4-phenylbenzoyl)amino]butanoate (PubChem CID 71163007) has the molecular formula C18H18N4O3 and a molecular weight of 338.37 g/mol. Its IUPAC name is methyl (2S,3R)-3-azido-2-[(4-phenylbenzoyl)amino]butanoate.
| Compound Name | methyl (2S,3R)-3-azido-2-[(4-phenylbenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 71163007 |
| Molecular Formula | C18H18N4O3 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | methyl (2S,3R)-3-azido-2-[(4-phenylbenzoyl)amino]butanoate |
| SMILES | COC(=O)[C@@H](NC(=O)c1ccc(-c2ccccc2)cc1)[C@@H](C)N=[N+]=[N-] |
| InChI | InChI=1S/C18H18N4O3/c1-12(21-22-19)16(18(24)25-2)20-17(23)15-10-8-14(9-11-15)13-6-4-3-5-7-13/h3-12,16H,1-2H3,(H,20,23)/t12-,16+/m1/s1 |
| InChIKey | IOZOEGAMKMRHNI-WBMJQRKESA-N |
| XLogP | 3.32 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|