methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate

C13H17NO5 — CID 11230931

IUPACmethyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate
SMILESCOC(=O)[C@@H](NC(=O)c1ccc(OC)cc1)[C@@H](C)O
InChIInChI=1S/C13H17NO5/c1-8(15)11(13(17)19-3)14-12(16)9-4-6-10(18-2)7-5-9/h4-8,11,15H,1-3H3,(H,14,16)/t8-,11+/m1/s1
InChIKeyIVGPUIRENVPOMY-KCJUWKMLSA-N
MW267.28 g/mol
LogP0.35
Rot. Bonds5

About methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate

methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate (PubChem CID 11230931) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate.

Molecular Properties

Compound Namemethyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate
PubChem CID11230931
Molecular FormulaC13H17NO5
Molecular Weight267.28 g/mol
Exact Mass267.11
IUPAC Namemethyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate
SMILESCOC(=O)[C@@H](NC(=O)c1ccc(OC)cc1)[C@@H](C)O
InChIInChI=1S/C13H17NO5/c1-8(15)11(13(17)19-3)14-12(16)9-4-6-10(18-2)7-5-9/h4-8,11,15H,1-3H3,(H,14,16)/t8-,11+/m1/s1
InChIKeyIVGPUIRENVPOMY-KCJUWKMLSA-N
XLogP0.35
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500267.28
LogP ≤ 50.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate?
The IUPAC name of methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate (CID 11230931) is methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate.
What is the SMILES notation for methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate?
The canonical SMILES for methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate is COC(=O)[C@@H](NC(=O)c1ccc(OC)cc1)[C@@H](C)O.
What is the InChIKey of methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate?
The InChIKey is IVGPUIRENVPOMY-KCJUWKMLSA-N. The full InChI is InChI=1S/C13H17NO5/c1-8(15)11(13(17)19-3)14-12(16)9-4-6-10(18-2)7-5-9/h4-8,11,15H,1-3H3,(H,14,16)/t8-,11+/m1/s1.
What are the key properties of methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate?
methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate has a molecular weight of 267.28 g/mol, XLogP of 0.35, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S,3R)-3-hydroxy-2-[(4-methoxybenzoyl)amino]butanoate is sourced from PubChem (CID 11230931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).