C19H21NO5 — CID 118161163
2-[[4-(6,7-dihydroxyhepta-1,3-diynyl)benzoyl]amino]-3-methylbutanoic acid (PubChem CID 118161163) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[[4-(6,7-dihydroxyhepta-1,3-diynyl)benzoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[4-(6,7-dihydroxyhepta-1,3-diynyl)benzoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 118161163 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[[4-(6,7-dihydroxyhepta-1,3-diynyl)benzoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)c1ccc(C#CC#CCC(O)CO)cc1)C(=O)O |
| InChI | InChI=1S/C19H21NO5/c1-13(2)17(19(24)25)20-18(23)15-10-8-14(9-11-15)6-4-3-5-7-16(22)12-21/h8-11,13,16-17,21-22H,7,12H2,1-2H3,(H,20,23)(H,24,25) |
| InChIKey | QXTDVKCQGOBABI-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|