C18H17N3O2 — CID 171510007
N-(1-amino-1-oxobutan-2-yl)-4-(2-pyridin-3-ylethynyl)benzamide (PubChem CID 171510007) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is N-(1-amino-1-oxobutan-2-yl)-4-(2-pyridin-3-ylethynyl)benzamide.
| Compound Name | N-(1-amino-1-oxobutan-2-yl)-4-(2-pyridin-3-ylethynyl)benzamide |
|---|---|
| PubChem CID | 171510007 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | N-(1-amino-1-oxobutan-2-yl)-4-(2-pyridin-3-ylethynyl)benzamide |
| SMILES | CCC(NC(=O)c1ccc(C#Cc2cccnc2)cc1)C(N)=O |
| InChI | InChI=1S/C18H17N3O2/c1-2-16(17(19)22)21-18(23)15-9-7-13(8-10-15)5-6-14-4-3-11-20-12-14/h3-4,7-12,16H,2H2,1H3,(H2,19,22)(H,21,23) |
| InChIKey | FKMHFMLVTODJPG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|