C22H18N2O3S — CID 155392848
(2S)-2-[[4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]benzoyl]amino]butanoic acid (PubChem CID 155392848) has the molecular formula C22H18N2O3S and a molecular weight of 390.46 g/mol. Its IUPAC name is (2S)-2-[[4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]benzoyl]amino]butanoic acid.
| Compound Name | (2S)-2-[[4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 155392848 |
| Molecular Formula | C22H18N2O3S |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | (2S)-2-[[4-[2-(5-pyridin-2-ylthiophen-2-yl)ethynyl]benzoyl]amino]butanoic acid |
| SMILES | CC[C@H](NC(=O)c1ccc(C#Cc2ccc(-c3ccccn3)s2)cc1)C(=O)O |
| InChI | InChI=1S/C22H18N2O3S/c1-2-18(22(26)27)24-21(25)16-9-6-15(7-10-16)8-11-17-12-13-20(28-17)19-5-3-4-14-23-19/h3-7,9-10,12-14,18H,2H2,1H3,(H,24,25)(H,26,27)/t18-/m0/s1 |
| InChIKey | AHZNPFIGPAKUOW-SFHVURJKSA-N |
| XLogP | 3.80 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|