C21H23NO — CID 25125996
N-(3,3-dimethylbutyl)-4-(2-phenylethynyl)benzamide (PubChem CID 25125996) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-4-(2-phenylethynyl)benzamide.
| Compound Name | N-(3,3-dimethylbutyl)-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 25125996 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | N-(3,3-dimethylbutyl)-4-(2-phenylethynyl)benzamide |
| SMILES | CC(C)(C)CCNC(=O)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO/c1-21(2,3)15-16-22-20(23)19-13-11-18(12-14-19)10-9-17-7-5-4-6-8-17/h4-8,11-14H,15-16H2,1-3H3,(H,22,23) |
| InChIKey | WEMKXESNFDLAFP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|