C23H24F2N2O4 — CID 122439317
N-[5,5-difluoro-4-hydroxy-3-(hydroxycarbamoyl)-3,4-dimethylpentyl]-4-(2-phenylethynyl)benzamide (PubChem CID 122439317) has the molecular formula C23H24F2N2O4 and a molecular weight of 430.45 g/mol. Its IUPAC name is N-[5,5-difluoro-4-hydroxy-3-(hydroxycarbamoyl)-3,4-dimethylpentyl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[5,5-difluoro-4-hydroxy-3-(hydroxycarbamoyl)-3,4-dimethylpentyl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 122439317 |
| Molecular Formula | C23H24F2N2O4 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | N-[5,5-difluoro-4-hydroxy-3-(hydroxycarbamoyl)-3,4-dimethylpentyl]-4-(2-phenylethynyl)benzamide |
| SMILES | CC(CCNC(=O)c1ccc(C#Cc2ccccc2)cc1)(C(=O)NO)C(C)(O)C(F)F |
| InChI | InChI=1S/C23H24F2N2O4/c1-22(21(29)27-31,23(2,30)20(24)25)14-15-26-19(28)18-12-10-17(11-13-18)9-8-16-6-4-3-5-7-16/h3-7,10-13,20,30-31H,14-15H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | YQBGYUQZUWFOFI-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|