C22H23F2N3O4 — CID 122439324
N-[[[4,4-difluoro-3-hydroxy-1-(hydroxyamino)-2,3-dimethyl-1-oxobutan-2-yl]amino]methyl]-4-(2-phenylethynyl)benzamide (PubChem CID 122439324) has the molecular formula C22H23F2N3O4 and a molecular weight of 431.44 g/mol. Its IUPAC name is N-[[[4,4-difluoro-3-hydroxy-1-(hydroxyamino)-2,3-dimethyl-1-oxobutan-2-yl]amino]methyl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[[[4,4-difluoro-3-hydroxy-1-(hydroxyamino)-2,3-dimethyl-1-oxobutan-2-yl]amino]methyl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 122439324 |
| Molecular Formula | C22H23F2N3O4 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | N-[[[4,4-difluoro-3-hydroxy-1-(hydroxyamino)-2,3-dimethyl-1-oxobutan-2-yl]amino]methyl]-4-(2-phenylethynyl)benzamide |
| SMILES | CC(NCNC(=O)c1ccc(C#Cc2ccccc2)cc1)(C(=O)NO)C(C)(O)C(F)F |
| InChI | InChI=1S/C22H23F2N3O4/c1-21(20(29)27-31,22(2,30)19(23)24)26-14-25-18(28)17-12-10-16(11-13-17)9-8-15-6-4-3-5-7-15/h3-7,10-13,19,26,30-31H,14H2,1-2H3,(H,25,28)(H,27,29) |
| InChIKey | UKCYIOQLYXUTRY-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|