C22H25N3O3 — CID 144791699
N-[2-[[(2S)-1-amino-3-hydroxy-3-methyl-1-oxobutan-2-yl]amino]ethyl]-4-(2-phenylethynyl)benzamide (PubChem CID 144791699) has the molecular formula C22H25N3O3 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[2-[[(2S)-1-amino-3-hydroxy-3-methyl-1-oxobutan-2-yl]amino]ethyl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[2-[[(2S)-1-amino-3-hydroxy-3-methyl-1-oxobutan-2-yl]amino]ethyl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 144791699 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | N-[2-[[(2S)-1-amino-3-hydroxy-3-methyl-1-oxobutan-2-yl]amino]ethyl]-4-(2-phenylethynyl)benzamide |
| SMILES | CC(C)(O)[C@H](NCCNC(=O)c1ccc(C#Cc2ccccc2)cc1)C(N)=O |
| InChI | InChI=1S/C22H25N3O3/c1-22(2,28)19(20(23)26)24-14-15-25-21(27)18-12-10-17(11-13-18)9-8-16-6-4-3-5-7-16/h3-7,10-13,19,24,28H,14-15H2,1-2H3,(H2,23,26)(H,25,27)/t19-/m1/s1 |
| InChIKey | SXVVTTNVLHIWND-LJQANCHMSA-N |
| XLogP | 1.03 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|