C19H21N3O3 — CID 158061303
N-[(2S)-2-amino-3-(hydroxyamino)-3-oxopropyl]-4-(2-phenylethynyl)benzamide;methane (PubChem CID 158061303) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is N-[(2S)-2-amino-3-(hydroxyamino)-3-oxopropyl]-4-(2-phenylethynyl)benzamide;methane.
| Compound Name | N-[(2S)-2-amino-3-(hydroxyamino)-3-oxopropyl]-4-(2-phenylethynyl)benzamide;methane |
|---|---|
| PubChem CID | 158061303 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | N-[(2S)-2-amino-3-(hydroxyamino)-3-oxopropyl]-4-(2-phenylethynyl)benzamide;methane |
| SMILES | C.N[C@@H](CNC(=O)c1ccc(C#Cc2ccccc2)cc1)C(=O)NO |
| InChI | InChI=1S/C18H17N3O3.CH4/c19-16(18(23)21-24)12-20-17(22)15-10-8-14(9-11-15)7-6-13-4-2-1-3-5-13;/h1-5,8-11,16,24H,12,19H2,(H,20,22)(H,21,23);1H4/t16-;/m0./s1 |
| InChIKey | FKRJDDLIVRJHKG-NTISSMGPSA-N |
| XLogP | 1.28 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|